C27H31NO6 — CID 71739591
3-[2-[tris(4-methoxyphenyl)methoxy]ethylamino]propanoic acid (PubChem CID 71739591) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[2-[tris(4-methoxyphenyl)methoxy]ethylamino]propanoic acid.
| Compound Name | 3-[2-[tris(4-methoxyphenyl)methoxy]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 71739591 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-[2-[tris(4-methoxyphenyl)methoxy]ethylamino]propanoic acid |
| SMILES | COc1ccc(C(OCCNCCC(=O)O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H31NO6/c1-31-23-10-4-20(5-11-23)27(21-6-12-24(32-2)13-7-21,22-8-14-25(33-3)15-9-22)34-19-18-28-17-16-26(29)30/h4-15,28H,16-19H2,1-3H3,(H,29,30) |
| InChIKey | GCIWBLKRYTXLGU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|