C20H22O6S — CID 19966360
3-(2-carboxyethylsulfanyl)-2,2-bis(4-methoxyphenyl)propanoic acid (PubChem CID 19966360) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-(2-carboxyethylsulfanyl)-2,2-bis(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-(2-carboxyethylsulfanyl)-2,2-bis(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19966360 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-(2-carboxyethylsulfanyl)-2,2-bis(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CSCCC(=O)O)(C(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H22O6S/c1-25-16-7-3-14(4-8-16)20(19(23)24,13-27-12-11-18(21)22)15-5-9-17(26-2)10-6-15/h3-10H,11-13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | GMGPNDCPHUSQQB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|