C19H22O4S — CID 10472821
3-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]propanoic acid (PubChem CID 10472821) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]propanoic acid.
| Compound Name | 3-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10472821 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]propanoic acid |
| SMILES | COc1ccc(CC(SCCC(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H22O4S/c1-22-16-7-3-14(4-8-16)13-18(24-12-11-19(20)21)15-5-9-17(23-2)10-6-15/h3-10,18H,11-13H2,1-2H3,(H,20,21) |
| InChIKey | UJDLZLIUHWHCNJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |