About (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate
(2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate (PubChem CID 24972903) has the molecular formula C11H16O5S
and a molecular weight of 260.31 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate |
| PubChem CID | 24972903 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)OOC(C)(C)C)cc1 |
| InChI | InChI=1S/C11H16O5S/c1-11(2,3)15-16-17(12,13)10-7-5-9(14-4)6-8-10/h5-8H,1-4H3 |
| InChIKey | SGNINBJCSHPLBA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate?
The IUPAC name of (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate (CID 24972903) is (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate.
What is the SMILES notation for (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate?
The canonical SMILES for (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate is COc1ccc(S(=O)(=O)OOC(C)(C)C)cc1.
What is the InChIKey of (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate?
The InChIKey is SGNINBJCSHPLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5S/c1-11(2,3)15-16-17(12,13)10-7-5-9(14-4)6-8-10/h5-8H,1-4H3.
What are the key properties of (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate?
(2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate has a molecular weight of 260.31 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy 4-methoxybenzenesulfonate is sourced from PubChem (CID 24972903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).