C34H41O6S2+ — CID 57011615
[(4-methoxyphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 57011615) has the molecular formula C34H41O6S2+ and a molecular weight of 609.83 g/mol. Its IUPAC name is [(4-methoxyphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
| Compound Name | [(4-methoxyphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 57011615 |
| Molecular Formula | C34H41O6S2+ |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | [(4-methoxyphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | COc1ccc(S([OH+]S(=O)(=O)c2ccc(C)cc2)(c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H40O6S2/c1-25-9-17-32(18-10-25)42(35,36)40-41(29-19-11-26(37-8)12-20-29,30-21-13-27(14-22-30)38-33(2,3)4)31-23-15-28(16-24-31)39-34(5,6)7/h9-24H,1-8H3/p+1 |
| InChIKey | LNUQGIYUTSUJMY-UHFFFAOYSA-O |
| XLogP | 9.04 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|