C23H26O4S2 — CID 172710050
4-methylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfanium (PubChem CID 172710050) has the molecular formula C23H26O4S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfanium.
| Compound Name | 4-methylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 172710050 |
| Molecular Formula | C23H26O4S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-methylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfanium |
| SMILES | CC(C)(C)Oc1ccc([SH+]c2ccccc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H18OS.C7H8O3S/c1-16(2,3)17-13-9-11-15(12-10-13)18-14-7-5-4-6-8-14;1-6-2-4-7(5-3-6)11(8,9)10/h4-12H,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FCYAGYCRSDBNJB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|