C46H42O10S4 — CID 23435194
6,7-bis-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium (PubChem CID 23435194) has the molecular formula C46H42O10S4 and a molecular weight of 883.10 g/mol. Its IUPAC name is 6,7-bis-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium.
| Compound Name | 6,7-bis-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 23435194 |
| Molecular Formula | C46H42O10S4 |
| Molecular Weight | 883.10 g/mol |
| Exact Mass | 882.17 |
| IUPAC Name | 6,7-bis-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.Cc1ccc(S(=O)(=O)Oc2cc3ccc(S(=O)(=O)[O-])cc3cc2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H20O9S3.C22H23OS/c1-16-3-8-20(9-4-16)35(28,29)32-23-14-18-7-12-22(34(25,26)27)13-19(18)15-24(23)33-36(30,31)21-10-5-17(2)6-11-21;1-22(2,3)23-18-14-16-21(17-15-18)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h3-15H,1-2H3,(H,25,26,27);4-17H,1-3H3/q;+1/p-1 |
| InChIKey | YMQKMPFSQDHIOP-UHFFFAOYSA-M |
| XLogP | 9.86 |
| TPSA | 153.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.10 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|