C22H23AsF6OS — CID 23133025
hexafluoroarsenic(1-);[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium (PubChem CID 23133025) has the molecular formula C22H23AsF6OS and a molecular weight of 524.40 g/mol. Its IUPAC name is hexafluoroarsenic(1-);[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium.
| Compound Name | hexafluoroarsenic(1-);[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 23133025 |
| Molecular Formula | C22H23AsF6OS |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | hexafluoroarsenic(1-);[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C22H23OS.AsF6/c1-22(2,3)23-18-14-16-21(17-15-18)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20;2-1(3,4,5,6)7/h4-17H,1-3H3;/q+1;-1 |
| InChIKey | YPAUFASQUQAZBQ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|