C34H33N2O3S+ — CID 22290221
[4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium (PubChem CID 22290221) has the molecular formula C34H33N2O3S+ and a molecular weight of 549.72 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium.
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 22290221 |
| Molecular Formula | C34H33N2O3S+ |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OCc3ccccn3)cc2)c2ccc(OCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C34H33N2O3S/c1-34(2,3)39-30-14-20-33(21-15-30)40(31-16-10-28(11-17-31)37-24-26-8-4-6-22-35-26)32-18-12-29(13-19-32)38-25-27-9-5-7-23-36-27/h4-23H,24-25H2,1-3H3/q+1 |
| InChIKey | VGCMSDVFJDKGQG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|