C42H45NO10S2 — CID 22290238
benzenesulfonate;bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(pyridin-2-ylmethoxy)phenyl]sulfanium (PubChem CID 22290238) has the molecular formula C42H45NO10S2 and a molecular weight of 787.95 g/mol. Its IUPAC name is benzenesulfonate;bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(pyridin-2-ylmethoxy)phenyl]sulfanium.
| Compound Name | benzenesulfonate;bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(pyridin-2-ylmethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 22290238 |
| Molecular Formula | C42H45NO10S2 |
| Molecular Weight | 787.95 g/mol |
| Exact Mass | 787.25 |
| IUPAC Name | benzenesulfonate;bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(pyridin-2-ylmethoxy)phenyl]sulfanium |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCc3ccccn3)cc2)cc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C36H40NO7S.C6H6O3S/c1-35(2,3)43-33(38)24-41-28-12-18-31(19-13-28)45(30-16-10-27(11-17-30)40-23-26-9-7-8-22-37-26)32-20-14-29(15-21-32)42-25-34(39)44-36(4,5)6;7-10(8,9)6-4-2-1-3-5-6/h7-22H,23-25H2,1-6H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | TVYXPVYACFRLHW-UHFFFAOYSA-M |
| XLogP | 7.79 |
| TPSA | 150.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.95 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|