C50H57N2O8S2+ — CID 161324263
[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium;octyl benzenesulfonate (PubChem CID 161324263) has the molecular formula C50H57N2O8S2+ and a molecular weight of 878.15 g/mol. Its IUPAC name is [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium;octyl benzenesulfonate.
| Compound Name | [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium;octyl benzenesulfonate |
|---|---|
| PubChem CID | 161324263 |
| Molecular Formula | C50H57N2O8S2+ |
| Molecular Weight | 878.15 g/mol |
| Exact Mass | 877.36 |
| IUPAC Name | [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-bis[4-(pyridin-2-ylmethoxy)phenyl]sulfanium;octyl benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccc(OCc3ccccn3)cc2)c2ccc(OCc3ccccn3)cc2)cc1.CCCCCCCCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H35N2O5S.C14H22O3S/c1-36(2,3)43-35(39)26-42-31-14-20-34(21-15-31)44(32-16-10-29(11-17-32)40-24-27-8-4-6-22-37-27)33-18-12-30(13-19-33)41-25-28-9-5-7-23-38-28;1-2-3-4-5-6-10-13-17-18(15,16)14-11-8-7-9-12-14/h4-23H,24-26H2,1-3H3;7-9,11-12H,2-6,10,13H2,1H3/q+1; |
| InChIKey | VKODOTAHXXWUNA-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 123.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.15 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|