About iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate
iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate (PubChem CID 87453679) has the molecular formula C14H12F3IO4S
and a molecular weight of 460.21 g/mol. Its IUPAC name is iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate |
| PubChem CID | 87453679 |
| Molecular Formula | C14H12F3IO4S |
| Molecular Weight | 460.21 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)cc1.Ic1ccccc1 |
| InChI | InChI=1S/C8H7F3O4S.C6H5I/c1-14-6-2-4-7(5-3-6)15-16(12,13)8(9,10)11;7-6-4-2-1-3-5-6/h2-5H,1H3;1-5H |
| InChIKey | VIGALRVYOUKSPE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate?
The IUPAC name of iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate (CID 87453679) is iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate.
What is the SMILES notation for iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate?
The canonical SMILES for iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate is COc1ccc(OS(=O)(=O)C(F)(F)F)cc1.Ic1ccccc1.
What is the InChIKey of iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate?
The InChIKey is VIGALRVYOUKSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O4S.C6H5I/c1-14-6-2-4-7(5-3-6)15-16(12,13)8(9,10)11;7-6-4-2-1-3-5-6/h2-5H,1H3;1-5H.
What are the key properties of iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate?
iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate has a molecular weight of 460.21 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iodobenzene;(4-methoxyphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 87453679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).