C25H22F3O5S4+ — CID 90745699
[bis(4-methoxyphenyl)-(5-phenylsulfanylthiophen-2-yl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 90745699) has the molecular formula C25H22F3O5S4+ and a molecular weight of 587.71 g/mol. Its IUPAC name is [bis(4-methoxyphenyl)-(5-phenylsulfanylthiophen-2-yl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [bis(4-methoxyphenyl)-(5-phenylsulfanylthiophen-2-yl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 90745699 |
| Molecular Formula | C25H22F3O5S4+ |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | [bis(4-methoxyphenyl)-(5-phenylsulfanylthiophen-2-yl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | COc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(OC)cc2)c2ccc(Sc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C25H21F3O5S4/c1-31-18-8-12-21(13-9-18)36(33-37(29,30)25(26,27)28,22-14-10-19(32-2)11-15-22)24-17-16-23(35-24)34-20-6-4-3-5-7-20/h3-17H,1-2H3/p+1 |
| InChIKey | VUJYOJXEYKCIEP-UHFFFAOYSA-O |
| XLogP | 8.06 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|