C22H22F3O4S2+ — CID 91366783
[(4-methoxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 91366783) has the molecular formula C22H22F3O4S2+ and a molecular weight of 471.54 g/mol. Its IUPAC name is [(4-methoxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [(4-methoxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 91366783 |
| Molecular Formula | C22H22F3O4S2+ |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | [(4-methoxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | COc1c(C)cc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C22H21F3O4S2/c1-16-14-20(15-17(2)21(16)28-3)30(18-10-6-4-7-11-18,19-12-8-5-9-13-19)29-31(26,27)22(23,24)25/h4-15H,1-3H3/p+1 |
| InChIKey | VEJRFFNWXNWFGV-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|