C20H16F5O3S2+ — CID 56981722
[bis(4-fluorophenyl)-(4-methylphenyl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 56981722) has the molecular formula C20H16F5O3S2+ and a molecular weight of 463.47 g/mol. Its IUPAC name is [bis(4-fluorophenyl)-(4-methylphenyl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [bis(4-fluorophenyl)-(4-methylphenyl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 56981722 |
| Molecular Formula | C20H16F5O3S2+ |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [bis(4-fluorophenyl)-(4-methylphenyl)-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | Cc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H15F5O3S2/c1-14-2-8-17(9-3-14)29(18-10-4-15(21)5-11-18,19-12-6-16(22)7-13-19)28-30(26,27)20(23,24)25/h2-13H,1H3/p+1 |
| InChIKey | KXTRLUNMQSFEPE-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|