C18H13F10NO2S — CID 11677675
4-methyl-N-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluorophenyl)pentyl]benzenesulfonamide (PubChem CID 11677675) has the molecular formula C18H13F10NO2S and a molecular weight of 497.35 g/mol. Its IUPAC name is 4-methyl-N-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluorophenyl)pentyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluorophenyl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11677675 |
| Molecular Formula | C18H13F10NO2S |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 4-methyl-N-[2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluorophenyl)pentyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccc(F)cc2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F10NO2S/c1-10-2-8-13(9-3-10)32(30,31)29-14(11-4-6-12(19)7-5-11)15(20,21)16(22,23)17(24,25)18(26,27)28/h2-9,14,29H,1H3 |
| InChIKey | OQSZKZYIHOOWAP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|