C23H18ClF2NO2S — CID 101486861
N-[1-(4-chlorophenyl)-2,2-difluoro-4-phenylbut-3-ynyl]-4-methylbenzenesulfonamide (PubChem CID 101486861) has the molecular formula C23H18ClF2NO2S and a molecular weight of 445.92 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,2-difluoro-4-phenylbut-3-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,2-difluoro-4-phenylbut-3-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101486861 |
| Molecular Formula | C23H18ClF2NO2S |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,2-difluoro-4-phenylbut-3-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccc(Cl)cc2)C(F)(F)C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClF2NO2S/c1-17-7-13-21(14-8-17)30(28,29)27-22(19-9-11-20(24)12-10-19)23(25,26)16-15-18-5-3-2-4-6-18/h2-14,22,27H,1H3 |
| InChIKey | PSBNPDPZOSWHKK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|