C27H30F3O6S2+ — CID 57109374
[bis(3-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 57109374) has the molecular formula C27H30F3O6S2+ and a molecular weight of 571.66 g/mol. Its IUPAC name is [bis(3-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [bis(3-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 57109374 |
| Molecular Formula | C27H30F3O6S2+ |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | [bis(3-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | Cc1cccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(OCC(=O)OC(C)(C)C)cc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C27H29F3O6S2/c1-19-8-6-10-23(16-19)37(24-11-7-9-20(2)17-24,36-38(32,33)27(28,29)30)22-14-12-21(13-15-22)34-18-25(31)35-26(3,4)5/h6-17H,18H2,1-5H3/p+1 |
| InChIKey | SDZDOHUYEHFGBN-UHFFFAOYSA-O |
| XLogP | 7.16 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|