C27H32F3O3S2+ — CID 90912410
[bis(4-tert-butylphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 90912410) has the molecular formula C27H32F3O3S2+ and a molecular weight of 525.68 g/mol. Its IUPAC name is [bis(4-tert-butylphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [bis(4-tert-butylphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 90912410 |
| Molecular Formula | C27H32F3O3S2+ |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [bis(4-tert-butylphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | CC(C)(C)c1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H31F3O3S2/c1-25(2,3)20-12-16-23(17-13-20)34(22-10-8-7-9-11-22,33-35(31,32)27(28,29)30)24-18-14-21(15-19-24)26(4,5)6/h7-19H,1-6H3/p+1 |
| InChIKey | BIDZVVIOVWTVTG-UHFFFAOYSA-O |
| XLogP | 8.42 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|