C23H23F2O6S2+ — CID 91282794
[1,1-difluoro-2-(2-methoxyethoxy)-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 91282794) has the molecular formula C23H23F2O6S2+ and a molecular weight of 497.56 g/mol. Its IUPAC name is [1,1-difluoro-2-(2-methoxyethoxy)-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | [1,1-difluoro-2-(2-methoxyethoxy)-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 91282794 |
| Molecular Formula | C23H23F2O6S2+ |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [1,1-difluoro-2-(2-methoxyethoxy)-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | COCCOC(=O)C(F)(F)S(=O)(=O)[OH+]S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22F2O6S2/c1-29-17-18-30-22(26)23(24,25)33(27,28)31-32(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16H,17-18H2,1H3/p+1 |
| InChIKey | ODAGQZJEIJTKHI-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|