C27H30ClF2O5S2+ — CID 91803678
[2-(7-chloroheptoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 91803678) has the molecular formula C27H30ClF2O5S2+ and a molecular weight of 572.12 g/mol. Its IUPAC name is [2-(7-chloroheptoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | [2-(7-chloroheptoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 91803678 |
| Molecular Formula | C27H30ClF2O5S2+ |
| Molecular Weight | 572.12 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | [2-(7-chloroheptoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | O=C(OCCCCCCCCl)C(F)(F)S(=O)(=O)[OH+]S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29ClF2O5S2/c28-21-13-2-1-3-14-22-34-26(31)27(29,30)37(32,33)35-36(23-15-7-4-8-16-23,24-17-9-5-10-18-24)25-19-11-6-12-20-25/h4-12,15-20H,1-3,13-14,21-22H2/p+1 |
| InChIKey | ASCXFPGKUDVADQ-UHFFFAOYSA-O |
| XLogP | 7.63 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.12 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|