About 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene
7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene (PubChem CID 87350480) has the molecular formula C27H28ClF3O5S2
and a molecular weight of 589.10 g/mol. Its IUPAC name is 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene |
| PubChem CID | 87350480 |
| Molecular Formula | C27H28ClF3O5S2 |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene |
| SMILES | O=C(OCCCCCCCCl)C(F)(F)S(=O)(=O)Oc1ccc(F)cc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18ClF3O5S.C12H10S/c16-10-4-2-1-3-5-11-23-14(20)15(18,19)25(21,22)24-13-8-6-12(17)7-9-13;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h6-9H,1-5,10-11H2;1-10H |
| InChIKey | XIJRAFUXDXQFTA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene?
The IUPAC name of 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene (CID 87350480) is 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene.
What is the SMILES notation for 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene?
The canonical SMILES for 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene is O=C(OCCCCCCCCl)C(F)(F)S(=O)(=O)Oc1ccc(F)cc1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene?
The InChIKey is XIJRAFUXDXQFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClF3O5S.C12H10S/c16-10-4-2-1-3-5-11-23-14(20)15(18,19)25(21,22)24-13-8-6-12(17)7-9-13;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h6-9H,1-5,10-11H2;1-10H.
What are the key properties of 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene?
7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene has a molecular weight of 589.10 g/mol, XLogP of 7.70, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloroheptyl 2,2-difluoro-2-(4-fluorophenoxy)sulfonylacetate;phenylsulfanylbenzene is sourced from PubChem (CID 87350480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).