C28H30BrF3O5S2 — CID 140547802
6-bromohexyl 2,2-difluoro-2-[(4-fluorophenyl)-bis(2-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate (PubChem CID 140547802) has the molecular formula C28H30BrF3O5S2 and a molecular weight of 647.57 g/mol. Its IUPAC name is 6-bromohexyl 2,2-difluoro-2-[(4-fluorophenyl)-bis(2-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
| Compound Name | 6-bromohexyl 2,2-difluoro-2-[(4-fluorophenyl)-bis(2-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
|---|---|
| PubChem CID | 140547802 |
| Molecular Formula | C28H30BrF3O5S2 |
| Molecular Weight | 647.57 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | 6-bromohexyl 2,2-difluoro-2-[(4-fluorophenyl)-bis(2-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| SMILES | Cc1ccccc1S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCBr)(c1ccc(F)cc1)c1ccccc1C |
| InChI | InChI=1S/C28H30BrF3O5S2/c1-21-11-5-7-13-25(21)38(24-17-15-23(30)16-18-24,26-14-8-6-12-22(26)2)37-39(34,35)28(31,32)27(33)36-20-10-4-3-9-19-29/h5-8,11-18H,3-4,9-10,19-20H2,1-2H3 |
| InChIKey | GLORGTXFANTUKU-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.57 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|