C26H24BrF5O5S2 — CID 87123837
2-(6-bromohexoxy)-1,1-difluoro-2-oxoethanesulfonate;tris(4-fluorophenyl)sulfanium (PubChem CID 87123837) has the molecular formula C26H24BrF5O5S2 and a molecular weight of 655.50 g/mol. Its IUPAC name is 2-(6-bromohexoxy)-1,1-difluoro-2-oxoethanesulfonate;tris(4-fluorophenyl)sulfanium.
| Compound Name | 2-(6-bromohexoxy)-1,1-difluoro-2-oxoethanesulfonate;tris(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 87123837 |
| Molecular Formula | C26H24BrF5O5S2 |
| Molecular Weight | 655.50 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | 2-(6-bromohexoxy)-1,1-difluoro-2-oxoethanesulfonate;tris(4-fluorophenyl)sulfanium |
| SMILES | Fc1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1.O=C(OCCCCCCBr)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C18H12F3S.C8H13BrF2O5S/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;9-5-3-1-2-4-6-16-7(12)8(10,11)17(13,14)15/h1-12H;1-6H2,(H,13,14,15)/q+1;/p-1 |
| InChIKey | MURLPXKUQBXPCF-UHFFFAOYSA-M |
| XLogP | 6.82 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|