C32H26F2O5S2 — CID 158053482
1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 158053482) has the molecular formula C32H26F2O5S2 and a molecular weight of 592.69 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 158053482 |
| Molecular Formula | C32H26F2O5S2 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | O=C(OCCc1cccc2ccccc12)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-14(16,22(18,19)20)13(17)21-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-15H;1-7H,8-9H2,(H,18,19,20)/q+1;/p-1 |
| InChIKey | FJTLLDHKYRSXFM-UHFFFAOYSA-M |
| XLogP | 6.85 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|