C27H29F3O5S2 — CID 158907215
4-(2,2-dimethylpropanoyloxy)-1,1,2-trifluorobutane-1-sulfonate;triphenylsulfanium (PubChem CID 158907215) has the molecular formula C27H29F3O5S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyloxy)-1,1,2-trifluorobutane-1-sulfonate;triphenylsulfanium.
| Compound Name | 4-(2,2-dimethylpropanoyloxy)-1,1,2-trifluorobutane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 158907215 |
| Molecular Formula | C27H29F3O5S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 4-(2,2-dimethylpropanoyloxy)-1,1,2-trifluorobutane-1-sulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)C(=O)OCCC(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H15F3O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(2,3)7(13)17-5-4-6(10)9(11,12)18(14,15)16/h1-15H;6H,4-5H2,1-3H3,(H,14,15,16)/q+1;/p-1 |
| InChIKey | JGEQTLMNYPALLR-UHFFFAOYSA-M |
| XLogP | 6.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|