C22H16F8O4S2 — CID 86609524
1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate;triphenylsulfanium (PubChem CID 86609524) has the molecular formula C22H16F8O4S2 and a molecular weight of 560.48 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86609524 |
| Molecular Formula | C22H16F8O4S2 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C4H2F8O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-1(2(6,7)17(13,14)15)16-4(11,12)3(8,9)10/h1-15H;1H,(H,13,14,15)/q+1;/p-1 |
| InChIKey | NKMPBLYLDBYTFZ-UHFFFAOYSA-M |
| XLogP | 6.37 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|