C3H5F6O4PS — CID 87619719
phosphanium 1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate (PubChem CID 87619719) has the molecular formula C3H5F6O4PS and a molecular weight of 282.10 g/mol. Its IUPAC name is phosphanium 1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate.
| Compound Name | phosphanium 1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 87619719 |
| Molecular Formula | C3H5F6O4PS |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | phosphanium 1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)F.[PH4+] |
| InChI | InChI=1S/C3H2F6O4S.H3P/c4-1(13-3(7,8)9)2(5,6)14(10,11)12;/h1H,(H,10,11,12);1H3 |
| InChIKey | YXIOOCKSSYNHPX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|