CFO9S3-3 — CID 59641509
fluoromethanetrisulfonate (PubChem CID 59641509) has the molecular formula CFO9S3-3 and a molecular weight of 271.20 g/mol. Its IUPAC name is fluoromethanetrisulfonate.
| Compound Name | fluoromethanetrisulfonate |
|---|---|
| PubChem CID | 59641509 |
| Molecular Formula | CFO9S3-3 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.87 |
| IUPAC Name | fluoromethanetrisulfonate |
| SMILES | O=S(=O)([O-])C(F)(S(=O)(=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/CH3FO9S3/c2-1(12(3,4)5,13(6,7)8)14(9,10)11/h(H,3,4,5)(H,6,7,8)(H,9,10,11)/p-3 |
| InChIKey | MNRLSOIXMFGQAI-UHFFFAOYSA-K |
| XLogP | -2.80 |
| TPSA | 171.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|