C4H9F3O4S2 — CID 160759853
sulfanium 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate (PubChem CID 160759853) has the molecular formula C4H9F3O4S2 and a molecular weight of 242.24 g/mol. Its IUPAC name is sulfanium 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate.
| Compound Name | sulfanium 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate |
|---|---|
| PubChem CID | 160759853 |
| Molecular Formula | C4H9F3O4S2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | sulfanium 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)CCO.[SH3+] |
| InChI | InChI=1S/C4H7F3O4S.H2S/c5-3(1-2-8)4(6,7)12(9,10)11;/h3,8H,1-2H2,(H,9,10,11);1H2 |
| InChIKey | RXXMIODYKYGMIQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|