C7H12F3KO3S — CID 122481633
potassium 1,1,2-trifluoroheptane-1-sulfonate (PubChem CID 122481633) has the molecular formula C7H12F3KO3S and a molecular weight of 272.33 g/mol. Its IUPAC name is potassium 1,1,2-trifluoroheptane-1-sulfonate.
| Compound Name | potassium 1,1,2-trifluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 122481633 |
| Molecular Formula | C7H12F3KO3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | potassium 1,1,2-trifluoroheptane-1-sulfonate |
| SMILES | CCCCCC(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C7H13F3O3S.K/c1-2-3-4-5-6(8)7(9,10)14(11,12)13;/h6H,2-5H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | OHDWYYXBGAHGTN-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|