C14H29F4O3PS — CID 162068588
1,1,2,2-tetrafluoroethanesulfonate;tributylphosphanium (PubChem CID 162068588) has the molecular formula C14H29F4O3PS and a molecular weight of 384.42 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethanesulfonate;tributylphosphanium.
| Compound Name | 1,1,2,2-tetrafluoroethanesulfonate;tributylphosphanium |
|---|---|
| PubChem CID | 162068588 |
| Molecular Formula | C14H29F4O3PS |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1,1,2,2-tetrafluoroethanesulfonate;tributylphosphanium |
| SMILES | CCCC[PH+](CCCC)CCCC.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C12H27P.C2H2F4O3S/c1-4-7-10-13(11-8-5-2)12-9-6-3;3-1(4)2(5,6)10(7,8)9/h4-12H2,1-3H3;1H,(H,7,8,9) |
| InChIKey | ZATUERZCEJRABD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|