About tributylphosphanium sulfate
tributylphosphanium sulfate (PubChem CID 19846650) has the molecular formula C12H28O4PS-
and a molecular weight of 299.39 g/mol. Its IUPAC name is tributylphosphanium sulfate.
Molecular Properties
| Compound Name | tributylphosphanium sulfate |
| PubChem CID | 19846650 |
| Molecular Formula | C12H28O4PS- |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tributylphosphanium sulfate |
| SMILES | CCCC[PH+](CCCC)CCCC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C12H27P.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12H2,1-3H3;(H2,1,2,3,4)/p-1 |
| InChIKey | QDUVKIFOULWJQB-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze tributylphosphanium sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylphosphanium sulfate?
The IUPAC name of tributylphosphanium sulfate (CID 19846650) is tributylphosphanium sulfate.
What is the SMILES notation for tributylphosphanium sulfate?
The canonical SMILES for tributylphosphanium sulfate is CCCC[PH+](CCCC)CCCC.O=S(=O)([O-])[O-].
What is the InChIKey of tributylphosphanium sulfate?
The InChIKey is QDUVKIFOULWJQB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27P.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12H2,1-3H3;(H2,1,2,3,4)/p-1.
What are the key properties of tributylphosphanium sulfate?
tributylphosphanium sulfate has a molecular weight of 299.39 g/mol, XLogP of 3.26, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributylphosphanium sulfate is sourced from PubChem (CID 19846650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).