About carbon monoxide;tributylphosphanium;tungsten
carbon monoxide;tributylphosphanium;tungsten (PubChem CID 6327341) has the molecular formula C17H28O5PW+
and a molecular weight of 527.22 g/mol. Its IUPAC name is carbon monoxide;tributylphosphanium;tungsten.
Molecular Properties
| Compound Name | carbon monoxide;tributylphosphanium;tungsten |
| PubChem CID | 6327341 |
| Molecular Formula | C17H28O5PW+ |
| Molecular Weight | 527.22 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | carbon monoxide;tributylphosphanium;tungsten |
| SMILES | CCCC[PH+](CCCC)CCCC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C12H27P.5CO.W/c1-4-7-10-13(11-8-5-2)12-9-6-3;5*1-2;/h4-12H2,1-3H3;;;;;;/p+1 |
| InChIKey | KZTSZIPULGBOCJ-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;tributylphosphanium;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;tributylphosphanium;tungsten?
The IUPAC name of carbon monoxide;tributylphosphanium;tungsten (CID 6327341) is carbon monoxide;tributylphosphanium;tungsten.
What is the SMILES notation for carbon monoxide;tributylphosphanium;tungsten?
The canonical SMILES for carbon monoxide;tributylphosphanium;tungsten is CCCC[PH+](CCCC)CCCC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;tributylphosphanium;tungsten?
The InChIKey is KZTSZIPULGBOCJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H27P.5CO.W/c1-4-7-10-13(11-8-5-2)12-9-6-3;5*1-2;/h4-12H2,1-3H3;;;;;;/p+1.
What are the key properties of carbon monoxide;tributylphosphanium;tungsten?
carbon monoxide;tributylphosphanium;tungsten has a molecular weight of 527.22 g/mol, XLogP of 4.41, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;tributylphosphanium;tungsten is sourced from PubChem (CID 6327341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).