About chloromethylbenzene;tributylphosphanium;chloride
chloromethylbenzene;tributylphosphanium;chloride (PubChem CID 160545991) has the molecular formula C19H35Cl2P
and a molecular weight of 365.37 g/mol. Its IUPAC name is chloromethylbenzene;tributylphosphanium;chloride.
Molecular Properties
| Compound Name | chloromethylbenzene;tributylphosphanium;chloride |
| PubChem CID | 160545991 |
| Molecular Formula | C19H35Cl2P |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | chloromethylbenzene;tributylphosphanium;chloride |
| SMILES | CCCC[PH+](CCCC)CCCC.ClCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H27P.C7H7Cl.ClH/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-6-7-4-2-1-3-5-7;/h4-12H2,1-3H3;1-5H,6H2;1H |
| InChIKey | IWABMHOFAWUZFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;tributylphosphanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;tributylphosphanium;chloride?
The IUPAC name of chloromethylbenzene;tributylphosphanium;chloride (CID 160545991) is chloromethylbenzene;tributylphosphanium;chloride.
What is the SMILES notation for chloromethylbenzene;tributylphosphanium;chloride?
The canonical SMILES for chloromethylbenzene;tributylphosphanium;chloride is CCCC[PH+](CCCC)CCCC.ClCc1ccccc1.[Cl-].
What is the InChIKey of chloromethylbenzene;tributylphosphanium;chloride?
The InChIKey is IWABMHOFAWUZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C7H7Cl.ClH/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-6-7-4-2-1-3-5-7;/h4-12H2,1-3H3;1-5H,6H2;1H.
What are the key properties of chloromethylbenzene;tributylphosphanium;chloride?
chloromethylbenzene;tributylphosphanium;chloride has a molecular weight of 365.37 g/mol, XLogP of 4.03, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;tributylphosphanium;chloride is sourced from PubChem (CID 160545991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).