About butyl(diphenyl)phosphanium;carbanide;dichlororuthenium
butyl(diphenyl)phosphanium;carbanide;dichlororuthenium (PubChem CID 155931991) has the molecular formula C17H23Cl2PRu
and a molecular weight of 430.32 g/mol. Its IUPAC name is butyl(diphenyl)phosphanium;carbanide;dichlororuthenium.
Molecular Properties
| Compound Name | butyl(diphenyl)phosphanium;carbanide;dichlororuthenium |
| PubChem CID | 155931991 |
| Molecular Formula | C17H23Cl2PRu |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | butyl(diphenyl)phosphanium;carbanide;dichlororuthenium |
| SMILES | CCCC[PH+](c1ccccc1)c1ccccc1.Cl[Ru]Cl.[CH3-] |
| InChI | InChI=1S/C16H19P.CH3.2ClH.Ru/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;;;;/h4-13H,2-3,14H2,1H3;1H3;2*1H;/q;-1;;;+2/p-1 |
| InChIKey | AOUJQYIAVPEEGB-UHFFFAOYSA-M |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl(diphenyl)phosphanium;carbanide;dichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(diphenyl)phosphanium;carbanide;dichlororuthenium?
The IUPAC name of butyl(diphenyl)phosphanium;carbanide;dichlororuthenium (CID 155931991) is butyl(diphenyl)phosphanium;carbanide;dichlororuthenium.
What is the SMILES notation for butyl(diphenyl)phosphanium;carbanide;dichlororuthenium?
The canonical SMILES for butyl(diphenyl)phosphanium;carbanide;dichlororuthenium is CCCC[PH+](c1ccccc1)c1ccccc1.Cl[Ru]Cl.[CH3-].
What is the InChIKey of butyl(diphenyl)phosphanium;carbanide;dichlororuthenium?
The InChIKey is AOUJQYIAVPEEGB-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H19P.CH3.2ClH.Ru/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;;;;/h4-13H,2-3,14H2,1H3;1H3;2*1H;/q;-1;;;+2/p-1.
What are the key properties of butyl(diphenyl)phosphanium;carbanide;dichlororuthenium?
butyl(diphenyl)phosphanium;carbanide;dichlororuthenium has a molecular weight of 430.32 g/mol, XLogP of 5.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(diphenyl)phosphanium;carbanide;dichlororuthenium is sourced from PubChem (CID 155931991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).