About bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+)
bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) (PubChem CID 6392769) has the molecular formula C34H36ClP3Pt+4
and a molecular weight of 768.12 g/mol. Its IUPAC name is bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+).
Molecular Properties
| Compound Name | bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) |
| PubChem CID | 6392769 |
| Molecular Formula | C34H36ClP3Pt+4 |
| Molecular Weight | 768.12 g/mol |
| Exact Mass | 767.13 |
| IUPAC Name | bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) |
| SMILES | Cl[Pt+].c1ccc([PH+](CC[PH+](c2ccccc2)c2ccccc2)CC[PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H33P3.ClH.Pt/c1-6-16-30(17-7-1)35(26-28-36(31-18-8-2-9-19-31)32-20-10-3-11-21-32)27-29-37(33-22-12-4-13-23-33)34-24-14-5-15-25-34;;/h1-25H,26-29H2;1H;/q;;+2/p+2 |
| InChIKey | RVRZJFPPOPZBMD-UHFFFAOYSA-P |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 768.12 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+)?
The IUPAC name of bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) (CID 6392769) is bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+).
What is the SMILES notation for bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+)?
The canonical SMILES for bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) is Cl[Pt+].c1ccc([PH+](CC[PH+](c2ccccc2)c2ccccc2)CC[PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+)?
The InChIKey is RVRZJFPPOPZBMD-UHFFFAOYSA-P. The full InChI is InChI=1S/C34H33P3.ClH.Pt/c1-6-16-30(17-7-1)35(26-28-36(31-18-8-2-9-19-31)32-20-10-3-11-21-32)27-29-37(33-22-12-4-13-23-33)34-24-14-5-15-25-34;;/h1-25H,26-29H2;1H;/q;;+2/p+2.
What are the key properties of bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+)?
bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) has a molecular weight of 768.12 g/mol, XLogP of 6.94, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-diphenylphosphaniumylethyl)-phenylphosphanium;chloroplatinum(1+) is sourced from PubChem (CID 6392769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).