About carbanide;dichlororuthenium;triphenylphosphanium
carbanide;dichlororuthenium;triphenylphosphanium (PubChem CID 59680687) has the molecular formula C19H19Cl2PRu
and a molecular weight of 450.31 g/mol. Its IUPAC name is carbanide;dichlororuthenium;triphenylphosphanium.
Molecular Properties
| Compound Name | carbanide;dichlororuthenium;triphenylphosphanium |
| PubChem CID | 59680687 |
| Molecular Formula | C19H19Cl2PRu |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | carbanide;dichlororuthenium;triphenylphosphanium |
| SMILES | Cl[Ru]Cl.[CH3-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CH3.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;1H3;2*1H;/q;-1;;;+2/p-1 |
| InChIKey | ABKAAJJECNVOGD-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dichlororuthenium;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dichlororuthenium;triphenylphosphanium?
The IUPAC name of carbanide;dichlororuthenium;triphenylphosphanium (CID 59680687) is carbanide;dichlororuthenium;triphenylphosphanium.
What is the SMILES notation for carbanide;dichlororuthenium;triphenylphosphanium?
The canonical SMILES for carbanide;dichlororuthenium;triphenylphosphanium is Cl[Ru]Cl.[CH3-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of carbanide;dichlororuthenium;triphenylphosphanium?
The InChIKey is ABKAAJJECNVOGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.CH3.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;1H3;2*1H;/q;-1;;;+2/p-1.
What are the key properties of carbanide;dichlororuthenium;triphenylphosphanium?
carbanide;dichlororuthenium;triphenylphosphanium has a molecular weight of 450.31 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dichlororuthenium;triphenylphosphanium is sourced from PubChem (CID 59680687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).