About dichloroplatinum;triphenylphosphanium
dichloroplatinum;triphenylphosphanium (PubChem CID 88797109) has the molecular formula C18H16Cl2PPt+
and a molecular weight of 529.28 g/mol. Its IUPAC name is dichloroplatinum;triphenylphosphanium.
Molecular Properties
| Compound Name | dichloroplatinum;triphenylphosphanium |
| PubChem CID | 88797109 |
| Molecular Formula | C18H16Cl2PPt+ |
| Molecular Weight | 529.28 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | dichloroplatinum;triphenylphosphanium |
| SMILES | Cl[Pt]Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2ClH.Pt/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q;;;+2/p-1 |
| InChIKey | NQNFKQOIDNMNBB-UHFFFAOYSA-M |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;triphenylphosphanium?
The IUPAC name of dichloroplatinum;triphenylphosphanium (CID 88797109) is dichloroplatinum;triphenylphosphanium.
What is the SMILES notation for dichloroplatinum;triphenylphosphanium?
The canonical SMILES for dichloroplatinum;triphenylphosphanium is Cl[Pt]Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichloroplatinum;triphenylphosphanium?
The InChIKey is NQNFKQOIDNMNBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.2ClH.Pt/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q;;;+2/p-1.
What are the key properties of dichloroplatinum;triphenylphosphanium?
dichloroplatinum;triphenylphosphanium has a molecular weight of 529.28 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;triphenylphosphanium is sourced from PubChem (CID 88797109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).