About tetrachloroosmium;bis(triphenylphosphanium)
tetrachloroosmium;bis(triphenylphosphanium) (PubChem CID 6389214) has the molecular formula C36H32Cl4OsP2+2
and a molecular weight of 858.64 g/mol. Its IUPAC name is tetrachloroosmium;bis(triphenylphosphanium).
Molecular Properties
| Compound Name | tetrachloroosmium;bis(triphenylphosphanium) |
| PubChem CID | 6389214 |
| Molecular Formula | C36H32Cl4OsP2+2 |
| Molecular Weight | 858.64 g/mol |
| Exact Mass | 858.03 |
| IUPAC Name | tetrachloroosmium;bis(triphenylphosphanium) |
| SMILES | Cl[Os](Cl)(Cl)Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15P.4ClH.Os/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h2*1-15H;4*1H;/q;;;;;;+4/p-2 |
| InChIKey | NTALNXGCBMVXNL-UHFFFAOYSA-L |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 858.64 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrachloroosmium;bis(triphenylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrachloroosmium;bis(triphenylphosphanium)?
The IUPAC name of tetrachloroosmium;bis(triphenylphosphanium) (CID 6389214) is tetrachloroosmium;bis(triphenylphosphanium).
What is the SMILES notation for tetrachloroosmium;bis(triphenylphosphanium)?
The canonical SMILES for tetrachloroosmium;bis(triphenylphosphanium) is Cl[Os](Cl)(Cl)Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetrachloroosmium;bis(triphenylphosphanium)?
The InChIKey is NTALNXGCBMVXNL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15P.4ClH.Os/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h2*1-15H;4*1H;/q;;;;;;+4/p-2.
What are the key properties of tetrachloroosmium;bis(triphenylphosphanium)?
tetrachloroosmium;bis(triphenylphosphanium) has a molecular weight of 858.64 g/mol, XLogP of 9.11, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrachloroosmium;bis(triphenylphosphanium) is sourced from PubChem (CID 6389214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).