About dioxopalladium;triphenylphosphanium
dioxopalladium;triphenylphosphanium (PubChem CID 174842290) has the molecular formula C18H16O2PPd+
and a molecular weight of 401.72 g/mol. Its IUPAC name is dioxopalladium;triphenylphosphanium.
Molecular Properties
| Compound Name | dioxopalladium;triphenylphosphanium |
| PubChem CID | 174842290 |
| Molecular Formula | C18H16O2PPd+ |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | dioxopalladium;triphenylphosphanium |
| SMILES | O=[Pd]=O.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2O.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;;/p+1 |
| InChIKey | AIHOQXHSEQSOPK-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxopalladium;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxopalladium;triphenylphosphanium?
The IUPAC name of dioxopalladium;triphenylphosphanium (CID 174842290) is dioxopalladium;triphenylphosphanium.
What is the SMILES notation for dioxopalladium;triphenylphosphanium?
The canonical SMILES for dioxopalladium;triphenylphosphanium is O=[Pd]=O.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dioxopalladium;triphenylphosphanium?
The InChIKey is AIHOQXHSEQSOPK-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.2O.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;;/p+1.
What are the key properties of dioxopalladium;triphenylphosphanium?
dioxopalladium;triphenylphosphanium has a molecular weight of 401.72 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioxopalladium;triphenylphosphanium is sourced from PubChem (CID 174842290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).