About nickel;tris(trifluorophosphanium);triphenylphosphanium
nickel;tris(trifluorophosphanium);triphenylphosphanium (PubChem CID 154702811) has the molecular formula C18H19F9NiP4+4
and a molecular weight of 588.92 g/mol. Its IUPAC name is nickel;tris(trifluorophosphanium);triphenylphosphanium.
Molecular Properties
| Compound Name | nickel;tris(trifluorophosphanium);triphenylphosphanium |
| PubChem CID | 154702811 |
| Molecular Formula | C18H19F9NiP4+4 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 587.96 |
| IUPAC Name | nickel;tris(trifluorophosphanium);triphenylphosphanium |
| SMILES | F[PH+](F)F.F[PH+](F)F.F[PH+](F)F.[Ni].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.3F3HP.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-4(2)3;/h1-15H;3*4H;/q;3*+1;/p+1 |
| InChIKey | ZUICNOMBZXHDNN-UHFFFAOYSA-O |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nickel;tris(trifluorophosphanium);triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;tris(trifluorophosphanium);triphenylphosphanium?
The IUPAC name of nickel;tris(trifluorophosphanium);triphenylphosphanium (CID 154702811) is nickel;tris(trifluorophosphanium);triphenylphosphanium.
What is the SMILES notation for nickel;tris(trifluorophosphanium);triphenylphosphanium?
The canonical SMILES for nickel;tris(trifluorophosphanium);triphenylphosphanium is F[PH+](F)F.F[PH+](F)F.F[PH+](F)F.[Ni].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of nickel;tris(trifluorophosphanium);triphenylphosphanium?
The InChIKey is ZUICNOMBZXHDNN-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.3F3HP.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-4(2)3;/h1-15H;3*4H;/q;3*+1;/p+1.
What are the key properties of nickel;tris(trifluorophosphanium);triphenylphosphanium?
nickel;tris(trifluorophosphanium);triphenylphosphanium has a molecular weight of 588.92 g/mol, XLogP of 8.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;tris(trifluorophosphanium);triphenylphosphanium is sourced from PubChem (CID 154702811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).