About hydron;triphenylphosphanium;ditetrafluoroborate
hydron;triphenylphosphanium;ditetrafluoroborate (PubChem CID 173429436) has the molecular formula C18H17B2F8P
and a molecular weight of 437.92 g/mol. Its IUPAC name is hydron;triphenylphosphanium;ditetrafluoroborate.
Molecular Properties
| Compound Name | hydron;triphenylphosphanium;ditetrafluoroborate |
| PubChem CID | 173429436 |
| Molecular Formula | C18H17B2F8P |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | hydron;triphenylphosphanium;ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.[H+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*2-1(3,4)5/h1-15H;;/q;2*-1/p+2 |
| InChIKey | PETASMJCXZEYPR-UHFFFAOYSA-P |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;triphenylphosphanium;ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;triphenylphosphanium;ditetrafluoroborate?
The IUPAC name of hydron;triphenylphosphanium;ditetrafluoroborate (CID 173429436) is hydron;triphenylphosphanium;ditetrafluoroborate.
What is the SMILES notation for hydron;triphenylphosphanium;ditetrafluoroborate?
The canonical SMILES for hydron;triphenylphosphanium;ditetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.[H+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hydron;triphenylphosphanium;ditetrafluoroborate?
The InChIKey is PETASMJCXZEYPR-UHFFFAOYSA-P. The full InChI is InChI=1S/C18H15P.2BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*2-1(3,4)5/h1-15H;;/q;2*-1/p+2.
What are the key properties of hydron;triphenylphosphanium;ditetrafluoroborate?
hydron;triphenylphosphanium;ditetrafluoroborate has a molecular weight of 437.92 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;triphenylphosphanium;ditetrafluoroborate is sourced from PubChem (CID 173429436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).