About carbanide;nickel;triphenylphosphanium
carbanide;nickel;triphenylphosphanium (PubChem CID 87436309) has the molecular formula C19H19NiP
and a molecular weight of 337.03 g/mol. Its IUPAC name is carbanide;nickel;triphenylphosphanium.
Molecular Properties
| Compound Name | carbanide;nickel;triphenylphosphanium |
| PubChem CID | 87436309 |
| Molecular Formula | C19H19NiP |
| Molecular Weight | 337.03 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | carbanide;nickel;triphenylphosphanium |
| SMILES | [CH3-].[Ni].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CH3.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H3;/q;-1;/p+1 |
| InChIKey | CROZTNDYLFRCOR-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.03 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;nickel;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;nickel;triphenylphosphanium?
The IUPAC name of carbanide;nickel;triphenylphosphanium (CID 87436309) is carbanide;nickel;triphenylphosphanium.
What is the SMILES notation for carbanide;nickel;triphenylphosphanium?
The canonical SMILES for carbanide;nickel;triphenylphosphanium is [CH3-].[Ni].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of carbanide;nickel;triphenylphosphanium?
The InChIKey is CROZTNDYLFRCOR-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.CH3.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H3;/q;-1;/p+1.
What are the key properties of carbanide;nickel;triphenylphosphanium?
carbanide;nickel;triphenylphosphanium has a molecular weight of 337.03 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;nickel;triphenylphosphanium is sourced from PubChem (CID 87436309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).