About triphenylphosphane
triphenylphosphane (PubChem CID 11776) has the molecular formula C18H15P
and a molecular weight of 262.29 g/mol. Its IUPAC name is triphenylphosphane.
Molecular Properties
| Compound Name | triphenylphosphane |
| PubChem CID | 11776 |
| Molecular Formula | C18H15P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | triphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylphosphane?
The IUPAC name of triphenylphosphane (CID 11776) is triphenylphosphane.
What is the SMILES notation for triphenylphosphane?
The canonical SMILES for triphenylphosphane is c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylphosphane?
The InChIKey is RIOQSEWOXXDEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of triphenylphosphane?
triphenylphosphane has a molecular weight of 262.29 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylphosphane is sourced from PubChem (CID 11776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).