About triphenylarsane
triphenylarsane (PubChem CID 11773) has the molecular formula C18H15As
and a molecular weight of 306.24 g/mol. Its IUPAC name is triphenylarsane.
Molecular Properties
| Compound Name | triphenylarsane |
| PubChem CID | 11773 |
| Molecular Formula | C18H15As |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | triphenylarsane |
| SMILES | c1ccc([As](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15As/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | BPLUKJNHPBNVQL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triphenylarsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylarsane?
The IUPAC name of triphenylarsane (CID 11773) is triphenylarsane.
What is the SMILES notation for triphenylarsane?
The canonical SMILES for triphenylarsane is c1ccc([As](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylarsane?
The InChIKey is BPLUKJNHPBNVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15As/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of triphenylarsane?
triphenylarsane has a molecular weight of 306.24 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylarsane is sourced from PubChem (CID 11773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).