About methanone;ruthenium(4+);triphenylphosphanium
methanone;ruthenium(4+);triphenylphosphanium (PubChem CID 87465370) has the molecular formula C22H20O4PRu+
and a molecular weight of 480.44 g/mol. Its IUPAC name is methanone;ruthenium(4+);triphenylphosphanium.
Molecular Properties
| Compound Name | methanone;ruthenium(4+);triphenylphosphanium |
| PubChem CID | 87465370 |
| Molecular Formula | C22H20O4PRu+ |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | methanone;ruthenium(4+);triphenylphosphanium |
| SMILES | [CH-]=O.[CH-]=O.[CH-]=O.[CH-]=O.[Ru+4].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.4CHO.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;4*1H;/q;4*-1;+4/p+1 |
| InChIKey | HEQXPAZWAOPZKP-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methanone;ruthenium(4+);triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanone;ruthenium(4+);triphenylphosphanium?
The IUPAC name of methanone;ruthenium(4+);triphenylphosphanium (CID 87465370) is methanone;ruthenium(4+);triphenylphosphanium.
What is the SMILES notation for methanone;ruthenium(4+);triphenylphosphanium?
The canonical SMILES for methanone;ruthenium(4+);triphenylphosphanium is [CH-]=O.[CH-]=O.[CH-]=O.[CH-]=O.[Ru+4].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methanone;ruthenium(4+);triphenylphosphanium?
The InChIKey is HEQXPAZWAOPZKP-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.4CHO.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;4*1H;/q;4*-1;+4/p+1.
What are the key properties of methanone;ruthenium(4+);triphenylphosphanium?
methanone;ruthenium(4+);triphenylphosphanium has a molecular weight of 480.44 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanone;ruthenium(4+);triphenylphosphanium is sourced from PubChem (CID 87465370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).