About 1,1'-biphenyl;triphenylphosphanium;hydroxide
1,1'-biphenyl;triphenylphosphanium;hydroxide (PubChem CID 18407779) has the molecular formula C30H27OP
and a molecular weight of 434.52 g/mol. Its IUPAC name is 1,1'-biphenyl;triphenylphosphanium;hydroxide.
Molecular Properties
| Compound Name | 1,1'-biphenyl;triphenylphosphanium;hydroxide |
| PubChem CID | 18407779 |
| Molecular Formula | C30H27OP |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1,1'-biphenyl;triphenylphosphanium;hydroxide |
| SMILES | [OH-].c1ccc(-c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H10.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-15H;1-10H;1H2 |
| InChIKey | NZMNCFCLQKFTRW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;triphenylphosphanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;triphenylphosphanium;hydroxide?
The IUPAC name of 1,1'-biphenyl;triphenylphosphanium;hydroxide (CID 18407779) is 1,1'-biphenyl;triphenylphosphanium;hydroxide.
What is the SMILES notation for 1,1'-biphenyl;triphenylphosphanium;hydroxide?
The canonical SMILES for 1,1'-biphenyl;triphenylphosphanium;hydroxide is [OH-].c1ccc(-c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;triphenylphosphanium;hydroxide?
The InChIKey is NZMNCFCLQKFTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C12H10.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-15H;1-10H;1H2.
What are the key properties of 1,1'-biphenyl;triphenylphosphanium;hydroxide?
1,1'-biphenyl;triphenylphosphanium;hydroxide has a molecular weight of 434.52 g/mol, XLogP of 6.35, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;triphenylphosphanium;hydroxide is sourced from PubChem (CID 18407779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).