About heptadecane;triphenylphosphanium;bromide
heptadecane;triphenylphosphanium;bromide (PubChem CID 18781891) has the molecular formula C35H52BrP
and a molecular weight of 583.68 g/mol. Its IUPAC name is heptadecane;triphenylphosphanium;bromide.
Molecular Properties
| Compound Name | heptadecane;triphenylphosphanium;bromide |
| PubChem CID | 18781891 |
| Molecular Formula | C35H52BrP |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | heptadecane;triphenylphosphanium;bromide |
| SMILES | CCCCCCCCCCCCCCCCC.[Br-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C17H36.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;/h1-15H;3-17H2,1-2H3;1H |
| InChIKey | ZWNYVGMYEVTYPX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptadecane;triphenylphosphanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecane;triphenylphosphanium;bromide?
The IUPAC name of heptadecane;triphenylphosphanium;bromide (CID 18781891) is heptadecane;triphenylphosphanium;bromide.
What is the SMILES notation for heptadecane;triphenylphosphanium;bromide?
The canonical SMILES for heptadecane;triphenylphosphanium;bromide is CCCCCCCCCCCCCCCCC.[Br-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of heptadecane;triphenylphosphanium;bromide?
The InChIKey is ZWNYVGMYEVTYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C17H36.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;/h1-15H;3-17H2,1-2H3;1H.
What are the key properties of heptadecane;triphenylphosphanium;bromide?
heptadecane;triphenylphosphanium;bromide has a molecular weight of 583.68 g/mol, XLogP of 7.06, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecane;triphenylphosphanium;bromide is sourced from PubChem (CID 18781891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).