C20H36Br2P+ — CID 19032175
1,4-bis(bromomethyl)benzene;tributylphosphanium (PubChem CID 19032175) has the molecular formula C20H36Br2P+ and a molecular weight of 467.29 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)benzene;tributylphosphanium.
| Compound Name | 1,4-bis(bromomethyl)benzene;tributylphosphanium |
|---|---|
| PubChem CID | 19032175 |
| Molecular Formula | C20H36Br2P+ |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1,4-bis(bromomethyl)benzene;tributylphosphanium |
| SMILES | BrCc1ccc(CBr)cc1.CCCC[PH+](CCCC)CCCC |
| InChI | InChI=1S/C12H27P.C8H8Br2/c1-4-7-10-13(11-8-5-2)12-9-6-3;9-5-7-1-2-8(6-10)4-3-7/h4-12H2,1-3H3;1-4H,5-6H2/p+1 |
| InChIKey | CMRNUZQZDSSWOW-UHFFFAOYSA-O |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|